ChemNet > CAS > 423768-54-1 2-morpholinonicotinic acid
423768-54-1 2-morpholinonicotinic acid
| produktnavn |
2-morpholinonicotinic acid |
| Synonymer |
2-morpholin-4-ylpyridine-3-carboxylic acid |
| Molekylær Formel |
C10H12N2O3 |
| Molekylvekt |
208.2139 |
| InChI |
InChI=1/C10H12N2O3/c13-10(14)8-2-1-3-11-9(8)12-4-6-15-7-5-12/h1-3H,4-7H2,(H,13,14) |
| CAS-nummer |
423768-54-1 |
| Molecular Structure |
|
| Tetthet |
1.313g/cm3 |
| Smeltepunkt |
130℃ |
| Kokepunkt |
418°C at 760 mmHg |
| Brytningsindeks |
1.584 |
| Flammepunktet |
206.6°C |
| Hazard symboler |
 Xi:Irritant;
|
| Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
